C18H10F6N2O7S2 — CID 19073284
1,1,1-trifluoro-N-(2-naphthalen-2-yloxy-4-nitrophenyl)-N-(trifluoromethylsulfonyl)methanesulfonamide (PubChem CID 19073284) has the molecular formula C18H10F6N2O7S2 and a molecular weight of 544.41 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-(2-naphthalen-2-yloxy-4-nitrophenyl)-N-(trifluoromethylsulfonyl)methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-(2-naphthalen-2-yloxy-4-nitrophenyl)-N-(trifluoromethylsulfonyl)methanesulfonamide |
|---|---|
| PubChem CID | 19073284 |
| Molecular Formula | C18H10F6N2O7S2 |
| Molecular Weight | 544.41 g/mol |
| Exact Mass | 543.98 |
| IUPAC Name | 1,1,1-trifluoro-N-(2-naphthalen-2-yloxy-4-nitrophenyl)-N-(trifluoromethylsulfonyl)methanesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(N(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)c(Oc2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C18H10F6N2O7S2/c19-17(20,21)34(29,30)26(35(31,32)18(22,23)24)15-8-6-13(25(27)28)10-16(15)33-14-7-5-11-3-1-2-4-12(11)9-14/h1-10H |
| InChIKey | RDGRBBHKAKGVIB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.41 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|