C16H21N3O9S2 — CID 11554451
1-aminopropan-2-ol;methylsulfonyl-(4-nitro-2-phenoxyphenyl)sulfamic acid (PubChem CID 11554451) has the molecular formula C16H21N3O9S2 and a molecular weight of 463.49 g/mol. Its IUPAC name is 1-aminopropan-2-ol;methylsulfonyl-(4-nitro-2-phenoxyphenyl)sulfamic acid.
| Compound Name | 1-aminopropan-2-ol;methylsulfonyl-(4-nitro-2-phenoxyphenyl)sulfamic acid |
|---|---|
| PubChem CID | 11554451 |
| Molecular Formula | C16H21N3O9S2 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | 1-aminopropan-2-ol;methylsulfonyl-(4-nitro-2-phenoxyphenyl)sulfamic acid |
| SMILES | CC(O)CN.CS(=O)(=O)N(c1ccc([N+](=O)[O-])cc1Oc1ccccc1)S(=O)(=O)O |
| InChI | InChI=1S/C13H12N2O8S2.C3H9NO/c1-24(18,19)15(25(20,21)22)12-8-7-10(14(16)17)9-13(12)23-11-5-3-2-4-6-11;1-3(5)2-4/h2-9H,1H3,(H,20,21,22);3,5H,2,4H2,1H3 |
| InChIKey | HISROLQZDKNCQJ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 190.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|