C15H20N2O7S — CID 156825304
tert-butyl N-[2-[2-(4-nitrophenyl)-2-oxoethyl]sulfonylethyl]carbamate (PubChem CID 156825304) has the molecular formula C15H20N2O7S and a molecular weight of 372.40 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(4-nitrophenyl)-2-oxoethyl]sulfonylethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-(4-nitrophenyl)-2-oxoethyl]sulfonylethyl]carbamate |
|---|---|
| PubChem CID | 156825304 |
| Molecular Formula | C15H20N2O7S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | tert-butyl N-[2-[2-(4-nitrophenyl)-2-oxoethyl]sulfonylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCS(=O)(=O)CC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H20N2O7S/c1-15(2,3)24-14(19)16-8-9-25(22,23)10-13(18)11-4-6-12(7-5-11)17(20)21/h4-7H,8-10H2,1-3H3,(H,16,19) |
| InChIKey | FWAQDDLGIZWZBX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|