C20H31N3O7 — CID 154444535
tert-butyl N-[6-[[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]amino]-6-oxohexyl]carbamate (PubChem CID 154444535) has the molecular formula C20H31N3O7 and a molecular weight of 425.48 g/mol. Its IUPAC name is tert-butyl N-[6-[[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]amino]-6-oxohexyl]carbamate.
| Compound Name | tert-butyl N-[6-[[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]amino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 154444535 |
| Molecular Formula | C20H31N3O7 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | tert-butyl N-[6-[[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]amino]-6-oxohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCC(=O)N[C@H](CO)[C@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H31N3O7/c1-20(2,3)30-19(27)21-12-6-4-5-7-17(25)22-16(13-24)18(26)14-8-10-15(11-9-14)23(28)29/h8-11,16,18,24,26H,4-7,12-13H2,1-3H3,(H,21,27)(H,22,25)/t16-,18-/m1/s1 |
| InChIKey | KVHFUUPCWPTQBS-SJLPKXTDSA-N |
| XLogP | 2.19 |
| TPSA | 151.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|