C34H42N4O5P+ — CID 146269157
[9-[[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]amino]-9-oxononyl]-(1-methylpyrazol-4-yl)-diphenylphosphanium (PubChem CID 146269157) has the molecular formula C34H42N4O5P+ and a molecular weight of 617.71 g/mol. Its IUPAC name is [9-[[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]amino]-9-oxononyl]-(1-methylpyrazol-4-yl)-diphenylphosphanium.
| Compound Name | [9-[[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]amino]-9-oxononyl]-(1-methylpyrazol-4-yl)-diphenylphosphanium |
|---|---|
| PubChem CID | 146269157 |
| Molecular Formula | C34H42N4O5P+ |
| Molecular Weight | 617.71 g/mol |
| Exact Mass | 617.29 |
| IUPAC Name | [9-[[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]amino]-9-oxononyl]-(1-methylpyrazol-4-yl)-diphenylphosphanium |
| SMILES | Cn1cc([P+](CCCCCCCCC(=O)N[C@H](CO)[C@H](O)c2ccc([N+](=O)[O-])cc2)(c2ccccc2)c2ccccc2)cn1 |
| InChI | InChI=1S/C34H41N4O5P/c1-37-25-31(24-35-37)44(29-14-8-6-9-15-29,30-16-10-7-11-17-30)23-13-5-3-2-4-12-18-33(40)36-32(26-39)34(41)27-19-21-28(22-20-27)38(42)43/h6-11,14-17,19-22,24-25,32,34,39,41H,2-5,12-13,18,23,26H2,1H3/p+1/t32-,34-/m1/s1 |
| InChIKey | VORDLQJDIPDPLM-ZFEZZJPFSA-O |
| XLogP | 4.56 |
| TPSA | 130.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.71 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|