C35H45N4O5P — CID 153372154
10-[hydroxy-(1-methylpyrazol-4-yl)-diphenyl-λ5-phosphanyl]-N-[(1R,2R)-1-hydroxy-1-(4-nitrophenyl)propan-2-yl]decanamide (PubChem CID 153372154) has the molecular formula C35H45N4O5P and a molecular weight of 632.74 g/mol. Its IUPAC name is 10-[hydroxy-(1-methylpyrazol-4-yl)-diphenyl-λ5-phosphanyl]-N-[(1R,2R)-1-hydroxy-1-(4-nitrophenyl)propan-2-yl]decanamide.
| Compound Name | 10-[hydroxy-(1-methylpyrazol-4-yl)-diphenyl-λ5-phosphanyl]-N-[(1R,2R)-1-hydroxy-1-(4-nitrophenyl)propan-2-yl]decanamide |
|---|---|
| PubChem CID | 153372154 |
| Molecular Formula | C35H45N4O5P |
| Molecular Weight | 632.74 g/mol |
| Exact Mass | 632.31 |
| IUPAC Name | 10-[hydroxy-(1-methylpyrazol-4-yl)-diphenyl-λ5-phosphanyl]-N-[(1R,2R)-1-hydroxy-1-(4-nitrophenyl)propan-2-yl]decanamide |
| SMILES | C[C@@H](NC(=O)CCCCCCCCCP(O)(c1ccccc1)(c1ccccc1)c1cnn(C)c1)[C@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C35H45N4O5P/c1-28(35(41)29-21-23-30(24-22-29)39(42)43)37-34(40)20-14-6-4-3-5-7-15-25-45(44,31-16-10-8-11-17-31,32-18-12-9-13-19-32)33-26-36-38(2)27-33/h8-13,16-19,21-24,26-28,35,41,44H,3-7,14-15,20,25H2,1-2H3,(H,37,40)/t28-,35+/m1/s1 |
| InChIKey | QMTRBAMCLQEWHJ-CVYDZTKKSA-N |
| XLogP | 5.42 |
| TPSA | 130.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.74 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|