C12H13F3N2O5 — CID 24861110
3,3,3-trifluoro-2-hydroxy-N-[(2R)-1-hydroxy-1-(4-nitrophenyl)propan-2-yl]propanamide (PubChem CID 24861110) has the molecular formula C12H13F3N2O5 and a molecular weight of 322.24 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-hydroxy-N-[(2R)-1-hydroxy-1-(4-nitrophenyl)propan-2-yl]propanamide.
| Compound Name | 3,3,3-trifluoro-2-hydroxy-N-[(2R)-1-hydroxy-1-(4-nitrophenyl)propan-2-yl]propanamide |
|---|---|
| PubChem CID | 24861110 |
| Molecular Formula | C12H13F3N2O5 |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 3,3,3-trifluoro-2-hydroxy-N-[(2R)-1-hydroxy-1-(4-nitrophenyl)propan-2-yl]propanamide |
| SMILES | C[C@@H](NC(=O)C(O)C(F)(F)F)C(O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H13F3N2O5/c1-6(16-11(20)10(19)12(13,14)15)9(18)7-2-4-8(5-3-7)17(21)22/h2-6,9-10,18-19H,1H3,(H,16,20)/t6-,9?,10?/m1/s1 |
| InChIKey | UZGJYPSYJXIHFI-STOUBEHRSA-N |
| XLogP | 1.06 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|