C15H22N4O6 — CID 44592734
(2S)-2-[[(2R,3S)-2-amino-3-hydroxy-3-(4-nitrophenyl)propanoyl]amino]-N-hydroxy-4-methylpentanamide (PubChem CID 44592734) has the molecular formula C15H22N4O6 and a molecular weight of 354.36 g/mol. Its IUPAC name is (2S)-2-[[(2R,3S)-2-amino-3-hydroxy-3-(4-nitrophenyl)propanoyl]amino]-N-hydroxy-4-methylpentanamide.
| Compound Name | (2S)-2-[[(2R,3S)-2-amino-3-hydroxy-3-(4-nitrophenyl)propanoyl]amino]-N-hydroxy-4-methylpentanamide |
|---|---|
| PubChem CID | 44592734 |
| Molecular Formula | C15H22N4O6 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (2S)-2-[[(2R,3S)-2-amino-3-hydroxy-3-(4-nitrophenyl)propanoyl]amino]-N-hydroxy-4-methylpentanamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](N)[C@@H](O)c1ccc([N+](=O)[O-])cc1)C(=O)NO |
| InChI | InChI=1S/C15H22N4O6/c1-8(2)7-11(14(21)18-23)17-15(22)12(16)13(20)9-3-5-10(6-4-9)19(24)25/h3-6,8,11-13,20,23H,7,16H2,1-2H3,(H,17,22)(H,18,21)/t11-,12+,13-/m0/s1 |
| InChIKey | WWWRDGWUZBSDDZ-XQQFMLRXSA-N |
| XLogP | -0.01 |
| TPSA | 167.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|