C13H17N3O6 — CID 44592696
4-[[(2R,3S)-2-amino-3-hydroxy-3-(4-nitrophenyl)propanoyl]amino]butanoic acid (PubChem CID 44592696) has the molecular formula C13H17N3O6 and a molecular weight of 311.29 g/mol. Its IUPAC name is 4-[[(2R,3S)-2-amino-3-hydroxy-3-(4-nitrophenyl)propanoyl]amino]butanoic acid.
| Compound Name | 4-[[(2R,3S)-2-amino-3-hydroxy-3-(4-nitrophenyl)propanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 44592696 |
| Molecular Formula | C13H17N3O6 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 4-[[(2R,3S)-2-amino-3-hydroxy-3-(4-nitrophenyl)propanoyl]amino]butanoic acid |
| SMILES | N[C@@H](C(=O)NCCCC(=O)O)[C@@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H17N3O6/c14-11(13(20)15-7-1-2-10(17)18)12(19)8-3-5-9(6-4-8)16(21)22/h3-6,11-12,19H,1-2,7,14H2,(H,15,20)(H,17,18)/t11-,12+/m1/s1 |
| InChIKey | XGQOGJPWJTXDHG-NEPJUHHUSA-N |
| XLogP | -0.06 |
| TPSA | 155.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|