C16H18Cl2N2O8 — CID 165340500
5-[(2R,3R)-2-[(2,2-dichloroacetyl)amino]-3-hydroxy-3-(4-nitrophenyl)propoxy]-5-oxopentanoic acid (PubChem CID 165340500) has the molecular formula C16H18Cl2N2O8 and a molecular weight of 437.23 g/mol. Its IUPAC name is 5-[(2R,3R)-2-[(2,2-dichloroacetyl)amino]-3-hydroxy-3-(4-nitrophenyl)propoxy]-5-oxopentanoic acid.
| Compound Name | 5-[(2R,3R)-2-[(2,2-dichloroacetyl)amino]-3-hydroxy-3-(4-nitrophenyl)propoxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 165340500 |
| Molecular Formula | C16H18Cl2N2O8 |
| Molecular Weight | 437.23 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | 5-[(2R,3R)-2-[(2,2-dichloroacetyl)amino]-3-hydroxy-3-(4-nitrophenyl)propoxy]-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)OC[C@@H](NC(=O)C(Cl)Cl)[C@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H18Cl2N2O8/c17-15(18)16(25)19-11(8-28-13(23)3-1-2-12(21)22)14(24)9-4-6-10(7-5-9)20(26)27/h4-7,11,14-15,24H,1-3,8H2,(H,19,25)(H,21,22)/t11-,14-/m1/s1 |
| InChIKey | AKNWAVNZAOKLTL-BXUZGUMPSA-N |
| XLogP | 1.71 |
| TPSA | 156.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.23 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|