C13H17N3O7 — CID 174283140
1,4-dinitrobenzene;(2S)-2-formamido-4-methylpentanoic acid (PubChem CID 174283140) has the molecular formula C13H17N3O7 and a molecular weight of 327.29 g/mol. Its IUPAC name is 1,4-dinitrobenzene;(2S)-2-formamido-4-methylpentanoic acid.
| Compound Name | 1,4-dinitrobenzene;(2S)-2-formamido-4-methylpentanoic acid |
|---|---|
| PubChem CID | 174283140 |
| Molecular Formula | C13H17N3O7 |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 1,4-dinitrobenzene;(2S)-2-formamido-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC=O)C(=O)O.O=[N+]([O-])c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C7H13NO3.C6H4N2O4/c1-5(2)3-6(7(10)11)8-4-9;9-7(10)5-1-2-6(4-3-5)8(11)12/h4-6H,3H2,1-2H3,(H,8,9)(H,10,11);1-4H/t6-;/m0./s1 |
| InChIKey | PPERCAPNXPPZDH-RGMNGODLSA-N |
| XLogP | 1.73 |
| TPSA | 152.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|