C35H54O2Si2 — CID 11092946
tert-butyl-[(2Z,3E,5E)-11-[tert-butyl(dimethyl)silyl]oxy-2-ethylideneundeca-3,5-dienoxy]-diphenylsilane (PubChem CID 11092946) has the molecular formula C35H54O2Si2 and a molecular weight of 562.99 g/mol. Its IUPAC name is tert-butyl-[(2Z,3E,5E)-11-[tert-butyl(dimethyl)silyl]oxy-2-ethylideneundeca-3,5-dienoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2Z,3E,5E)-11-[tert-butyl(dimethyl)silyl]oxy-2-ethylideneundeca-3,5-dienoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11092946 |
| Molecular Formula | C35H54O2Si2 |
| Molecular Weight | 562.99 g/mol |
| Exact Mass | 562.37 |
| IUPAC Name | tert-butyl-[(2Z,3E,5E)-11-[tert-butyl(dimethyl)silyl]oxy-2-ethylideneundeca-3,5-dienoxy]-diphenylsilane |
| SMILES | C/C=C(/C=C/C=C/CCCCCO[Si](C)(C)C(C)(C)C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H54O2Si2/c1-10-31(24-18-14-12-11-13-15-23-29-36-38(8,9)34(2,3)4)30-37-39(35(5,6)7,32-25-19-16-20-26-32)33-27-21-17-22-28-33/h10,12,14,16-22,24-28H,11,13,15,23,29-30H2,1-9H3/b14-12+,24-18+,31-10- |
| InChIKey | SQJZCNFDGNUBEY-FWIRQJDWSA-N |
| XLogP | 9.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.99 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|