C20H36O2 — CID 21437666
ethyl (2E,4E)-3,4,5,7,11,11-hexamethyldodeca-2,4-dienoate (PubChem CID 21437666) has the molecular formula C20H36O2 and a molecular weight of 308.51 g/mol. Its IUPAC name is ethyl (2E,4E)-3,4,5,7,11,11-hexamethyldodeca-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-3,4,5,7,11,11-hexamethyldodeca-2,4-dienoate |
|---|---|
| PubChem CID | 21437666 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | ethyl (2E,4E)-3,4,5,7,11,11-hexamethyldodeca-2,4-dienoate |
| SMILES | CCOC(=O)/C=C(C)/C(C)=C(\C)CC(C)CCCC(C)(C)C |
| InChI | InChI=1S/C20H36O2/c1-9-22-19(21)14-17(4)18(5)16(3)13-15(2)11-10-12-20(6,7)8/h14-15H,9-13H2,1-8H3/b17-14+,18-16+ |
| InChIKey | AFPKHKFHJYSQNF-MLHBKYQTSA-N |
| XLogP | 6.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|