C20H34O2 — CID 54553058
ethyl 11-ethyl-3,5,7-trimethyltrideca-2,4,10-trienoate (PubChem CID 54553058) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is ethyl 11-ethyl-3,5,7-trimethyltrideca-2,4,10-trienoate.
| Compound Name | ethyl 11-ethyl-3,5,7-trimethyltrideca-2,4,10-trienoate |
|---|---|
| PubChem CID | 54553058 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | ethyl 11-ethyl-3,5,7-trimethyltrideca-2,4,10-trienoate |
| SMILES | CCOC(=O)C=C(C)C=C(C)CC(C)CCC=C(CC)CC |
| InChI | InChI=1S/C20H34O2/c1-7-19(8-2)12-10-11-16(4)13-17(5)14-18(6)15-20(21)22-9-3/h12,14-16H,7-11,13H2,1-6H3 |
| InChIKey | ZLGAEUTWRNLLGF-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|