C21H34O2 — CID 71713852
ethyl (2E,4S,6R,8E,10E,12E)-4,6,8,10,12-pentamethyltetradeca-2,8,10,12-tetraenoate (PubChem CID 71713852) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is ethyl (2E,4S,6R,8E,10E,12E)-4,6,8,10,12-pentamethyltetradeca-2,8,10,12-tetraenoate.
| Compound Name | ethyl (2E,4S,6R,8E,10E,12E)-4,6,8,10,12-pentamethyltetradeca-2,8,10,12-tetraenoate |
|---|---|
| PubChem CID | 71713852 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | ethyl (2E,4S,6R,8E,10E,12E)-4,6,8,10,12-pentamethyltetradeca-2,8,10,12-tetraenoate |
| SMILES | C/C=C(C)/C=C(C)/C=C(\C)C[C@H](C)C[C@H](C)/C=C/C(=O)OCC |
| InChI | InChI=1S/C21H34O2/c1-8-16(3)12-18(5)14-20(7)15-19(6)13-17(4)10-11-21(22)23-9-2/h8,10-12,14,17,19H,9,13,15H2,1-7H3/b11-10+,16-8+,18-12+,20-14+/t17-,19-/m1/s1 |
| InChIKey | CNOIPIVBURPHOD-CCBJMGNTSA-N |
| XLogP | 6.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|