C16H28O — CID 54470288
3,5,7,11-tetramethyldodeca-2,4,10-trien-1-ol (PubChem CID 54470288) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is 3,5,7,11-tetramethyldodeca-2,4,10-trien-1-ol.
| Compound Name | 3,5,7,11-tetramethyldodeca-2,4,10-trien-1-ol |
|---|---|
| PubChem CID | 54470288 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | 3,5,7,11-tetramethyldodeca-2,4,10-trien-1-ol |
| SMILES | CC(C)=CCCC(C)CC(C)=CC(C)=CCO |
| InChI | InChI=1S/C16H28O/c1-13(2)7-6-8-14(3)11-16(5)12-15(4)9-10-17/h7,9,12,14,17H,6,8,10-11H2,1-5H3 |
| InChIKey | XHVSHVDVADUFQC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|