C27H44O3Si — CID 10928395
(2E,6Z,9S,10S)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-10-phenylmethoxyundeca-2,6-dienal (PubChem CID 10928395) has the molecular formula C27H44O3Si and a molecular weight of 444.73 g/mol. Its IUPAC name is (2E,6Z,9S,10S)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-10-phenylmethoxyundeca-2,6-dienal.
| Compound Name | (2E,6Z,9S,10S)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-10-phenylmethoxyundeca-2,6-dienal |
|---|---|
| PubChem CID | 10928395 |
| Molecular Formula | C27H44O3Si |
| Molecular Weight | 444.73 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | (2E,6Z,9S,10S)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-10-phenylmethoxyundeca-2,6-dienal |
| SMILES | C/C(=C/C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)OCc1ccccc1)CC(C)/C=C(\C)C=O |
| InChI | InChI=1S/C27H44O3Si/c1-21(17-22(2)18-23(3)19-28)15-16-26(30-31(8,9)27(5,6)7)24(4)29-20-25-13-11-10-12-14-25/h10-15,18-19,22,24,26H,16-17,20H2,1-9H3/b21-15-,23-18+/t22?,24-,26-/m0/s1 |
| InChIKey | QAKAFLNYPPVGGH-IYNGZPNFSA-N |
| XLogP | 7.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.73 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|