C27H37BrO3Si — CID 10984127
[3-[bis(phenylmethoxy)methyl]-2-bromocyclohex-2-en-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10984127) has the molecular formula C27H37BrO3Si and a molecular weight of 517.58 g/mol. Its IUPAC name is [3-[bis(phenylmethoxy)methyl]-2-bromocyclohex-2-en-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [3-[bis(phenylmethoxy)methyl]-2-bromocyclohex-2-en-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10984127 |
| Molecular Formula | C27H37BrO3Si |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | [3-[bis(phenylmethoxy)methyl]-2-bromocyclohex-2-en-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCCC(C(OCc2ccccc2)OCc2ccccc2)=C1Br |
| InChI | InChI=1S/C27H37BrO3Si/c1-27(2,3)32(4,5)31-24-18-12-17-23(25(24)28)26(29-19-21-13-8-6-9-14-21)30-20-22-15-10-7-11-16-22/h6-11,13-16,24,26H,12,17-20H2,1-5H3 |
| InChIKey | GIOCVFVDMVGEBM-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|