C21H35IO5Si — CID 10029709
(2S,3R)-3-[(2S,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-(iodomethyl)oxolan-2-yl]-3-phenylmethoxypropane-1,2-diol (PubChem CID 10029709) has the molecular formula C21H35IO5Si and a molecular weight of 522.50 g/mol. Its IUPAC name is (2S,3R)-3-[(2S,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-(iodomethyl)oxolan-2-yl]-3-phenylmethoxypropane-1,2-diol.
| Compound Name | (2S,3R)-3-[(2S,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-(iodomethyl)oxolan-2-yl]-3-phenylmethoxypropane-1,2-diol |
|---|---|
| PubChem CID | 10029709 |
| Molecular Formula | C21H35IO5Si |
| Molecular Weight | 522.50 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | (2S,3R)-3-[(2S,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-(iodomethyl)oxolan-2-yl]-3-phenylmethoxypropane-1,2-diol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@@H](CI)O[C@H]1[C@H](OCc1ccccc1)[C@@H](O)CO |
| InChI | InChI=1S/C21H35IO5Si/c1-21(2,3)28(4,5)27-18-11-16(12-22)26-20(18)19(17(24)13-23)25-14-15-9-7-6-8-10-15/h6-10,16-20,23-24H,11-14H2,1-5H3/t16-,17-,18-,19+,20+/m0/s1 |
| InChIKey | FJVYRNPKIHBPDI-WKWVNEEDSA-N |
| XLogP | 3.91 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|