C17H19Cl2NO3 — CID 15892212
methyl 3-[benzyl(cyclohexen-1-yl)amino]-2,2-dichloro-3-oxopropanoate (PubChem CID 15892212) has the molecular formula C17H19Cl2NO3 and a molecular weight of 356.25 g/mol. Its IUPAC name is methyl 3-[benzyl(cyclohexen-1-yl)amino]-2,2-dichloro-3-oxopropanoate.
| Compound Name | methyl 3-[benzyl(cyclohexen-1-yl)amino]-2,2-dichloro-3-oxopropanoate |
|---|---|
| PubChem CID | 15892212 |
| Molecular Formula | C17H19Cl2NO3 |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | methyl 3-[benzyl(cyclohexen-1-yl)amino]-2,2-dichloro-3-oxopropanoate |
| SMILES | COC(=O)C(Cl)(Cl)C(=O)N(Cc1ccccc1)C1=CCCCC1 |
| InChI | InChI=1S/C17H19Cl2NO3/c1-23-16(22)17(18,19)15(21)20(14-10-6-3-7-11-14)12-13-8-4-2-5-9-13/h2,4-5,8-10H,3,6-7,11-12H2,1H3 |
| InChIKey | RGBGYTNKPRMMCA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|