C18H17Cl2NO — CID 143002886
N-benzyl-1-(3,4-dichlorophenyl)-N-methylcyclopropane-1-carboxamide (PubChem CID 143002886) has the molecular formula C18H17Cl2NO and a molecular weight of 334.25 g/mol. Its IUPAC name is N-benzyl-1-(3,4-dichlorophenyl)-N-methylcyclopropane-1-carboxamide.
| Compound Name | N-benzyl-1-(3,4-dichlorophenyl)-N-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 143002886 |
| Molecular Formula | C18H17Cl2NO |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | N-benzyl-1-(3,4-dichlorophenyl)-N-methylcyclopropane-1-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)C1(c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C18H17Cl2NO/c1-21(12-13-5-3-2-4-6-13)17(22)18(9-10-18)14-7-8-15(19)16(20)11-14/h2-8,11H,9-10,12H2,1H3 |
| InChIKey | FJGQDBZAIMLKTR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |