C21H20BrN3O — CID 55521841
1-(4-bromophenyl)-N-methyl-N-[(1-phenylpyrazol-4-yl)methyl]cyclopropane-1-carboxamide (PubChem CID 55521841) has the molecular formula C21H20BrN3O and a molecular weight of 410.32 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-methyl-N-[(1-phenylpyrazol-4-yl)methyl]cyclopropane-1-carboxamide.
| Compound Name | 1-(4-bromophenyl)-N-methyl-N-[(1-phenylpyrazol-4-yl)methyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 55521841 |
| Molecular Formula | C21H20BrN3O |
| Molecular Weight | 410.32 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 1-(4-bromophenyl)-N-methyl-N-[(1-phenylpyrazol-4-yl)methyl]cyclopropane-1-carboxamide |
| SMILES | CN(Cc1cnn(-c2ccccc2)c1)C(=O)C1(c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C21H20BrN3O/c1-24(14-16-13-23-25(15-16)19-5-3-2-4-6-19)20(26)21(11-12-21)17-7-9-18(22)10-8-17/h2-10,13,15H,11-12,14H2,1H3 |
| InChIKey | XOLLXECZYGLLND-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.32 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |