About propyl N-(3,4-dichlorophenyl)-N-hydroxycarbamate
propyl N-(3,4-dichlorophenyl)-N-hydroxycarbamate (PubChem CID 3999317) has the molecular formula C10H11Cl2NO3
and a molecular weight of 264.11 g/mol. Its IUPAC name is propyl N-(3,4-dichlorophenyl)-N-hydroxycarbamate.
Molecular Properties
| Compound Name | propyl N-(3,4-dichlorophenyl)-N-hydroxycarbamate |
| PubChem CID | 3999317 |
| Molecular Formula | C10H11Cl2NO3 |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | propyl N-(3,4-dichlorophenyl)-N-hydroxycarbamate |
| SMILES | CCCOC(=O)N(O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H11Cl2NO3/c1-2-5-16-10(14)13(15)7-3-4-8(11)9(12)6-7/h3-4,6,15H,2,5H2,1H3 |
| InChIKey | RTOAELYIJFQIRA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze propyl N-(3,4-dichlorophenyl)-N-hydroxycarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl N-(3,4-dichlorophenyl)-N-hydroxycarbamate?
The IUPAC name of propyl N-(3,4-dichlorophenyl)-N-hydroxycarbamate (CID 3999317) is propyl N-(3,4-dichlorophenyl)-N-hydroxycarbamate.
What is the SMILES notation for propyl N-(3,4-dichlorophenyl)-N-hydroxycarbamate?
The canonical SMILES for propyl N-(3,4-dichlorophenyl)-N-hydroxycarbamate is CCCOC(=O)N(O)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of propyl N-(3,4-dichlorophenyl)-N-hydroxycarbamate?
The InChIKey is RTOAELYIJFQIRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11Cl2NO3/c1-2-5-16-10(14)13(15)7-3-4-8(11)9(12)6-7/h3-4,6,15H,2,5H2,1H3.
What are the key properties of propyl N-(3,4-dichlorophenyl)-N-hydroxycarbamate?
propyl N-(3,4-dichlorophenyl)-N-hydroxycarbamate has a molecular weight of 264.11 g/mol, XLogP of 3.74, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl N-(3,4-dichlorophenyl)-N-hydroxycarbamate is sourced from PubChem (CID 3999317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).