C15H21Cl2N4O3+ — CID 21442382
(3,4-dichlorophenyl)carbamoyl-(dimethylcarbamoyl)-methyl-(C-propoxycarbonimidoyl)azanium (PubChem CID 21442382) has the molecular formula C15H21Cl2N4O3+ and a molecular weight of 376.26 g/mol. Its IUPAC name is (3,4-dichlorophenyl)carbamoyl-(dimethylcarbamoyl)-methyl-(C-propoxycarbonimidoyl)azanium.
| Compound Name | (3,4-dichlorophenyl)carbamoyl-(dimethylcarbamoyl)-methyl-(C-propoxycarbonimidoyl)azanium |
|---|---|
| PubChem CID | 21442382 |
| Molecular Formula | C15H21Cl2N4O3+ |
| Molecular Weight | 376.26 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | (3,4-dichlorophenyl)carbamoyl-(dimethylcarbamoyl)-methyl-(C-propoxycarbonimidoyl)azanium |
| SMILES | [H]/N=C(\OCCC)[N+](C)(C(=O)Nc1ccc(Cl)c(Cl)c1)C(=O)N(C)C |
| InChI | InChI=1S/C15H20Cl2N4O3/c1-5-8-24-13(18)21(4,15(23)20(2)3)14(22)19-10-6-7-11(16)12(17)9-10/h6-7,9,18H,5,8H2,1-4H3/p+1/b18-13- |
| InChIKey | HMNKGQAVNZAXDG-AQTBWJFISA-O |
| XLogP | 4.01 |
| TPSA | 82.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.26 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|