C16H13Cl3N2O5 — CID 4046130
2-[(2,4-dichlorophenoxy)carbonylamino]ethyl N-(4-chlorophenyl)-N-hydroxycarbamate (PubChem CID 4046130) has the molecular formula C16H13Cl3N2O5 and a molecular weight of 419.65 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenoxy)carbonylamino]ethyl N-(4-chlorophenyl)-N-hydroxycarbamate.
| Compound Name | 2-[(2,4-dichlorophenoxy)carbonylamino]ethyl N-(4-chlorophenyl)-N-hydroxycarbamate |
|---|---|
| PubChem CID | 4046130 |
| Molecular Formula | C16H13Cl3N2O5 |
| Molecular Weight | 419.65 g/mol |
| Exact Mass | 417.99 |
| IUPAC Name | 2-[(2,4-dichlorophenoxy)carbonylamino]ethyl N-(4-chlorophenyl)-N-hydroxycarbamate |
| SMILES | O=C(NCCOC(=O)N(O)c1ccc(Cl)cc1)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H13Cl3N2O5/c17-10-1-4-12(5-2-10)21(24)16(23)25-8-7-20-15(22)26-14-6-3-11(18)9-13(14)19/h1-6,9,24H,7-8H2,(H,20,22) |
| InChIKey | PWHOLRVRXRMPMG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.65 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|