C10H12Cl2N2O3S — CID 806054
2-(3,4-dichloro-N-methylsulfonylanilino)-N-methylacetamide (PubChem CID 806054) has the molecular formula C10H12Cl2N2O3S and a molecular weight of 311.19 g/mol. Its IUPAC name is 2-(3,4-dichloro-N-methylsulfonylanilino)-N-methylacetamide.
| Compound Name | 2-(3,4-dichloro-N-methylsulfonylanilino)-N-methylacetamide |
|---|---|
| PubChem CID | 806054 |
| Molecular Formula | C10H12Cl2N2O3S |
| Molecular Weight | 311.19 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | 2-(3,4-dichloro-N-methylsulfonylanilino)-N-methylacetamide |
| SMILES | CNC(=O)CN(c1ccc(Cl)c(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C10H12Cl2N2O3S/c1-13-10(15)6-14(18(2,16)17)7-3-4-8(11)9(12)5-7/h3-5H,6H2,1-2H3,(H,13,15) |
| InChIKey | ASDKSLYONSQEPK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.19 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |