C14H18N2O4S — CID 15523871
N-(8-cyano-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-(2,2-dimethoxyethyl)methanesulfonamide (PubChem CID 15523871) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is N-(8-cyano-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-(2,2-dimethoxyethyl)methanesulfonamide.
| Compound Name | N-(8-cyano-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-(2,2-dimethoxyethyl)methanesulfonamide |
|---|---|
| PubChem CID | 15523871 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | N-(8-cyano-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-(2,2-dimethoxyethyl)methanesulfonamide |
| SMILES | COC(CN(c1ccc2c(c1)C(C#N)C2)S(C)(=O)=O)OC |
| InChI | InChI=1S/C14H18N2O4S/c1-19-14(20-2)9-16(21(3,17)18)12-5-4-10-6-11(8-15)13(10)7-12/h4-5,7,11,14H,6,9H2,1-3H3 |
| InChIKey | IDOYVJKSPBDLQC-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|