C20H21NO6S — CID 59704808
methyl (2S)-2-hydroxy-3-[4-[2-(4-methoxyphenyl)ethynyl]-N-methylsulfonylanilino]propanoate (PubChem CID 59704808) has the molecular formula C20H21NO6S and a molecular weight of 403.46 g/mol. Its IUPAC name is methyl (2S)-2-hydroxy-3-[4-[2-(4-methoxyphenyl)ethynyl]-N-methylsulfonylanilino]propanoate.
| Compound Name | methyl (2S)-2-hydroxy-3-[4-[2-(4-methoxyphenyl)ethynyl]-N-methylsulfonylanilino]propanoate |
|---|---|
| PubChem CID | 59704808 |
| Molecular Formula | C20H21NO6S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | methyl (2S)-2-hydroxy-3-[4-[2-(4-methoxyphenyl)ethynyl]-N-methylsulfonylanilino]propanoate |
| SMILES | COC(=O)[C@@H](O)CN(c1ccc(C#Cc2ccc(OC)cc2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C20H21NO6S/c1-26-18-12-8-16(9-13-18)5-4-15-6-10-17(11-7-15)21(28(3,24)25)14-19(22)20(23)27-2/h6-13,19,22H,14H2,1-3H3/t19-/m0/s1 |
| InChIKey | OSWPYUOVVGYQSY-IBGZPJMESA-N |
| XLogP | 1.39 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|