C15H12Cl2N2O3S — CID 4987406
3,5-dichloro-N-(2-cyanoethyl)-2-hydroxy-N-phenylbenzenesulfonamide (PubChem CID 4987406) has the molecular formula C15H12Cl2N2O3S and a molecular weight of 371.25 g/mol. Its IUPAC name is 3,5-dichloro-N-(2-cyanoethyl)-2-hydroxy-N-phenylbenzenesulfonamide.
| Compound Name | 3,5-dichloro-N-(2-cyanoethyl)-2-hydroxy-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 4987406 |
| Molecular Formula | C15H12Cl2N2O3S |
| Molecular Weight | 371.25 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | 3,5-dichloro-N-(2-cyanoethyl)-2-hydroxy-N-phenylbenzenesulfonamide |
| SMILES | N#CCCN(c1ccccc1)S(=O)(=O)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C15H12Cl2N2O3S/c16-11-9-13(17)15(20)14(10-11)23(21,22)19(8-4-7-18)12-5-2-1-3-6-12/h1-3,5-6,9-10,20H,4,8H2 |
| InChIKey | GVLYVCSPQNCXRI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.25 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|