C13H14N4O2S — CID 60910953
N-(2-cyanoethyl)-5-methyl-N-phenyl-1H-pyrazole-4-sulfonamide (PubChem CID 60910953) has the molecular formula C13H14N4O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is N-(2-cyanoethyl)-5-methyl-N-phenyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(2-cyanoethyl)-5-methyl-N-phenyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 60910953 |
| Molecular Formula | C13H14N4O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | N-(2-cyanoethyl)-5-methyl-N-phenyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1[nH]ncc1S(=O)(=O)N(CCC#N)c1ccccc1 |
| InChI | InChI=1S/C13H14N4O2S/c1-11-13(10-15-16-11)20(18,19)17(9-5-8-14)12-6-3-2-4-7-12/h2-4,6-7,10H,5,9H2,1H3,(H,15,16) |
| InChIKey | JTMDIAPCSJFYFK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |