C12H10ClN3O2S2 — CID 43455903
2-chloro-N-(2-cyanoethyl)-N-phenyl-1,3-thiazole-5-sulfonamide (PubChem CID 43455903) has the molecular formula C12H10ClN3O2S2 and a molecular weight of 327.82 g/mol. Its IUPAC name is 2-chloro-N-(2-cyanoethyl)-N-phenyl-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-chloro-N-(2-cyanoethyl)-N-phenyl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 43455903 |
| Molecular Formula | C12H10ClN3O2S2 |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | 2-chloro-N-(2-cyanoethyl)-N-phenyl-1,3-thiazole-5-sulfonamide |
| SMILES | N#CCCN(c1ccccc1)S(=O)(=O)c1cnc(Cl)s1 |
| InChI | InChI=1S/C12H10ClN3O2S2/c13-12-15-9-11(19-12)20(17,18)16(8-4-7-14)10-5-2-1-3-6-10/h1-3,5-6,9H,4,8H2 |
| InChIKey | UNTYWCVROYEMFF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 74.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |