C8H15N3O4S — CID 60960308
N,N-bis(2-hydroxyethyl)-5-methyl-1H-pyrazole-4-sulfonamide (PubChem CID 60960308) has the molecular formula C8H15N3O4S and a molecular weight of 249.29 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-5-methyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N,N-bis(2-hydroxyethyl)-5-methyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 60960308 |
| Molecular Formula | C8H15N3O4S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-5-methyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1[nH]ncc1S(=O)(=O)N(CCO)CCO |
| InChI | InChI=1S/C8H15N3O4S/c1-7-8(6-9-10-7)16(14,15)11(2-4-12)3-5-13/h6,12-13H,2-5H2,1H3,(H,9,10) |
| InChIKey | CZXDHEXYLNIRSH-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 106.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |