C12H21N3O4S — CID 60959588
methyl 3-[2-methylpropyl-[(5-methyl-1H-pyrazol-4-yl)sulfonyl]amino]propanoate (PubChem CID 60959588) has the molecular formula C12H21N3O4S and a molecular weight of 303.38 g/mol. Its IUPAC name is methyl 3-[2-methylpropyl-[(5-methyl-1H-pyrazol-4-yl)sulfonyl]amino]propanoate.
| Compound Name | methyl 3-[2-methylpropyl-[(5-methyl-1H-pyrazol-4-yl)sulfonyl]amino]propanoate |
|---|---|
| PubChem CID | 60959588 |
| Molecular Formula | C12H21N3O4S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | methyl 3-[2-methylpropyl-[(5-methyl-1H-pyrazol-4-yl)sulfonyl]amino]propanoate |
| SMILES | COC(=O)CCN(CC(C)C)S(=O)(=O)c1cn[nH]c1C |
| InChI | InChI=1S/C12H21N3O4S/c1-9(2)8-15(6-5-12(16)19-4)20(17,18)11-7-13-14-10(11)3/h7,9H,5-6,8H2,1-4H3,(H,13,14) |
| InChIKey | IFSMLXSHYKVCPR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |