C10H18N4O5S — CID 115533331
methyl 3-[(5-amino-1H-pyrazol-4-yl)sulfonyl-(2-methoxyethyl)amino]propanoate (PubChem CID 115533331) has the molecular formula C10H18N4O5S and a molecular weight of 306.34 g/mol. Its IUPAC name is methyl 3-[(5-amino-1H-pyrazol-4-yl)sulfonyl-(2-methoxyethyl)amino]propanoate.
| Compound Name | methyl 3-[(5-amino-1H-pyrazol-4-yl)sulfonyl-(2-methoxyethyl)amino]propanoate |
|---|---|
| PubChem CID | 115533331 |
| Molecular Formula | C10H18N4O5S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | methyl 3-[(5-amino-1H-pyrazol-4-yl)sulfonyl-(2-methoxyethyl)amino]propanoate |
| SMILES | COCCN(CCC(=O)OC)S(=O)(=O)c1cn[nH]c1N |
| InChI | InChI=1S/C10H18N4O5S/c1-18-6-5-14(4-3-9(15)19-2)20(16,17)8-7-12-13-10(8)11/h7H,3-6H2,1-2H3,(H3,11,12,13) |
| InChIKey | GPXZHVSIZCUAKZ-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 127.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |