C17H15ClN2O4S — CID 167956747
4-chloro-3-[2-cyanoethyl-(3-methylphenyl)sulfamoyl]benzoic acid (PubChem CID 167956747) has the molecular formula C17H15ClN2O4S and a molecular weight of 378.84 g/mol. Its IUPAC name is 4-chloro-3-[2-cyanoethyl-(3-methylphenyl)sulfamoyl]benzoic acid.
| Compound Name | 4-chloro-3-[2-cyanoethyl-(3-methylphenyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 167956747 |
| Molecular Formula | C17H15ClN2O4S |
| Molecular Weight | 378.84 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 4-chloro-3-[2-cyanoethyl-(3-methylphenyl)sulfamoyl]benzoic acid |
| SMILES | Cc1cccc(N(CCC#N)S(=O)(=O)c2cc(C(=O)O)ccc2Cl)c1 |
| InChI | InChI=1S/C17H15ClN2O4S/c1-12-4-2-5-14(10-12)20(9-3-8-19)25(23,24)16-11-13(17(21)22)6-7-15(16)18/h2,4-7,10-11H,3,9H2,1H3,(H,21,22) |
| InChIKey | KNUGAXGFDHKJKW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.84 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |