C15H21N3O2S — CID 29032011
N-(2-cyanoethyl)-4-methyl-N-phenylpiperidine-1-sulfonamide (PubChem CID 29032011) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is N-(2-cyanoethyl)-4-methyl-N-phenylpiperidine-1-sulfonamide.
| Compound Name | N-(2-cyanoethyl)-4-methyl-N-phenylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 29032011 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | N-(2-cyanoethyl)-4-methyl-N-phenylpiperidine-1-sulfonamide |
| SMILES | CC1CCN(S(=O)(=O)N(CCC#N)c2ccccc2)CC1 |
| InChI | InChI=1S/C15H21N3O2S/c1-14-8-12-17(13-9-14)21(19,20)18(11-5-10-16)15-6-3-2-4-7-15/h2-4,6-7,14H,5,8-9,11-13H2,1H3 |
| InChIKey | FENBJEODGBWGDZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |