C13H20N2O3S — CID 111462838
N-(2-hydroxyethyl)-N-phenylpiperidine-1-sulfonamide (PubChem CID 111462838) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N-phenylpiperidine-1-sulfonamide.
| Compound Name | N-(2-hydroxyethyl)-N-phenylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 111462838 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | N-(2-hydroxyethyl)-N-phenylpiperidine-1-sulfonamide |
| SMILES | O=S(=O)(N1CCCCC1)N(CCO)c1ccccc1 |
| InChI | InChI=1S/C13H20N2O3S/c16-12-11-15(13-7-3-1-4-8-13)19(17,18)14-9-5-2-6-10-14/h1,3-4,7-8,16H,2,5-6,9-12H2 |
| InChIKey | RVPFQKLAJCFNBP-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |