C15H20N4O3S — CID 35431424
4-benzoyl-N-(2-cyanoethyl)-N-methylpiperazine-1-sulfonamide (PubChem CID 35431424) has the molecular formula C15H20N4O3S and a molecular weight of 336.42 g/mol. Its IUPAC name is 4-benzoyl-N-(2-cyanoethyl)-N-methylpiperazine-1-sulfonamide.
| Compound Name | 4-benzoyl-N-(2-cyanoethyl)-N-methylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 35431424 |
| Molecular Formula | C15H20N4O3S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 4-benzoyl-N-(2-cyanoethyl)-N-methylpiperazine-1-sulfonamide |
| SMILES | CN(CCC#N)S(=O)(=O)N1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C15H20N4O3S/c1-17(9-5-8-16)23(21,22)19-12-10-18(11-13-19)15(20)14-6-3-2-4-7-14/h2-4,6-7H,5,9-13H2,1H3 |
| InChIKey | IDMLFGHYYHBFOF-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |