C21H31N5O4S — CID 56516478
N-(2-cyanoethyl)-4-[4-(diethylsulfamoyl)piperazin-1-yl]-4-oxo-N-phenylbutanamide (PubChem CID 56516478) has the molecular formula C21H31N5O4S and a molecular weight of 449.58 g/mol. Its IUPAC name is N-(2-cyanoethyl)-4-[4-(diethylsulfamoyl)piperazin-1-yl]-4-oxo-N-phenylbutanamide.
| Compound Name | N-(2-cyanoethyl)-4-[4-(diethylsulfamoyl)piperazin-1-yl]-4-oxo-N-phenylbutanamide |
|---|---|
| PubChem CID | 56516478 |
| Molecular Formula | C21H31N5O4S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | N-(2-cyanoethyl)-4-[4-(diethylsulfamoyl)piperazin-1-yl]-4-oxo-N-phenylbutanamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCN(C(=O)CCC(=O)N(CCC#N)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H31N5O4S/c1-3-24(4-2)31(29,30)25-17-15-23(16-18-25)20(27)11-12-21(28)26(14-8-13-22)19-9-6-5-7-10-19/h5-7,9-10H,3-4,8,11-12,14-18H2,1-2H3 |
| InChIKey | WFBYFXKRRGGNEC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 105.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |