C23H32N4O3 — CID 56577984
N-(2-cyanoethyl)-4-[4-(morpholin-4-ylmethyl)piperidin-1-yl]-4-oxo-N-phenylbutanamide (PubChem CID 56577984) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is N-(2-cyanoethyl)-4-[4-(morpholin-4-ylmethyl)piperidin-1-yl]-4-oxo-N-phenylbutanamide.
| Compound Name | N-(2-cyanoethyl)-4-[4-(morpholin-4-ylmethyl)piperidin-1-yl]-4-oxo-N-phenylbutanamide |
|---|---|
| PubChem CID | 56577984 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | N-(2-cyanoethyl)-4-[4-(morpholin-4-ylmethyl)piperidin-1-yl]-4-oxo-N-phenylbutanamide |
| SMILES | N#CCCN(C(=O)CCC(=O)N1CCC(CN2CCOCC2)CC1)c1ccccc1 |
| InChI | InChI=1S/C23H32N4O3/c24-11-4-12-27(21-5-2-1-3-6-21)23(29)8-7-22(28)26-13-9-20(10-14-26)19-25-15-17-30-18-16-25/h1-3,5-6,20H,4,7-10,12-19H2 |
| InChIKey | HDISRNCCRFTLKY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 76.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |