C23H24ClN3O3 — CID 56577901
4-[2-(4-chlorophenyl)morpholin-4-yl]-N-(2-cyanoethyl)-4-oxo-N-phenylbutanamide (PubChem CID 56577901) has the molecular formula C23H24ClN3O3 and a molecular weight of 425.92 g/mol. Its IUPAC name is 4-[2-(4-chlorophenyl)morpholin-4-yl]-N-(2-cyanoethyl)-4-oxo-N-phenylbutanamide.
| Compound Name | 4-[2-(4-chlorophenyl)morpholin-4-yl]-N-(2-cyanoethyl)-4-oxo-N-phenylbutanamide |
|---|---|
| PubChem CID | 56577901 |
| Molecular Formula | C23H24ClN3O3 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 4-[2-(4-chlorophenyl)morpholin-4-yl]-N-(2-cyanoethyl)-4-oxo-N-phenylbutanamide |
| SMILES | N#CCCN(C(=O)CCC(=O)N1CCOC(c2ccc(Cl)cc2)C1)c1ccccc1 |
| InChI | InChI=1S/C23H24ClN3O3/c24-19-9-7-18(8-10-19)21-17-26(15-16-30-21)22(28)11-12-23(29)27(14-4-13-25)20-5-2-1-3-6-20/h1-3,5-10,21H,4,11-12,14-17H2 |
| InChIKey | BLLLKMADKYDUAP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |