C15H14BrNO4S — CID 18197816
N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-bromobenzenesulfonamide (PubChem CID 18197816) has the molecular formula C15H14BrNO4S and a molecular weight of 384.25 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-bromobenzenesulfonamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-bromobenzenesulfonamide |
|---|---|
| PubChem CID | 18197816 |
| Molecular Formula | C15H14BrNO4S |
| Molecular Weight | 384.25 g/mol |
| Exact Mass | 382.98 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-bromobenzenesulfonamide |
| SMILES | O=S(=O)(NCCc1ccc2c(c1)OCO2)c1ccccc1Br |
| InChI | InChI=1S/C15H14BrNO4S/c16-12-3-1-2-4-15(12)22(18,19)17-8-7-11-5-6-13-14(9-11)21-10-20-13/h1-6,9,17H,7-8,10H2 |
| InChIKey | WKOFFGYPOGZXME-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |