C14H11Br2NO4S — CID 1075102
N-(1,3-benzodioxol-5-ylmethyl)-2,4-dibromobenzenesulfonamide (PubChem CID 1075102) has the molecular formula C14H11Br2NO4S and a molecular weight of 449.12 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2,4-dibromobenzenesulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2,4-dibromobenzenesulfonamide |
|---|---|
| PubChem CID | 1075102 |
| Molecular Formula | C14H11Br2NO4S |
| Molecular Weight | 449.12 g/mol |
| Exact Mass | 446.88 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2,4-dibromobenzenesulfonamide |
| SMILES | O=S(=O)(NCc1ccc2c(c1)OCO2)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C14H11Br2NO4S/c15-10-2-4-14(11(16)6-10)22(18,19)17-7-9-1-3-12-13(5-9)21-8-20-12/h1-6,17H,7-8H2 |
| InChIKey | OSPSOORZIRGNQQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.12 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |