C10H12BrNO5S — CID 114361339
4-bromo-3-(2-hydroxyethylsulfamoyl)-5-methylbenzoic acid (PubChem CID 114361339) has the molecular formula C10H12BrNO5S and a molecular weight of 338.18 g/mol. Its IUPAC name is 4-bromo-3-(2-hydroxyethylsulfamoyl)-5-methylbenzoic acid.
| Compound Name | 4-bromo-3-(2-hydroxyethylsulfamoyl)-5-methylbenzoic acid |
|---|---|
| PubChem CID | 114361339 |
| Molecular Formula | C10H12BrNO5S |
| Molecular Weight | 338.18 g/mol |
| Exact Mass | 336.96 |
| IUPAC Name | 4-bromo-3-(2-hydroxyethylsulfamoyl)-5-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(S(=O)(=O)NCCO)c1Br |
| InChI | InChI=1S/C10H12BrNO5S/c1-6-4-7(10(14)15)5-8(9(6)11)18(16,17)12-2-3-13/h4-5,12-13H,2-3H2,1H3,(H,14,15) |
| InChIKey | JTMPOEIJECKNES-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.18 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |