C11H14BrNO6S — CID 114362735
4-bromo-3-(2-methoxyethoxysulfamoyl)-5-methylbenzoic acid (PubChem CID 114362735) has the molecular formula C11H14BrNO6S and a molecular weight of 368.21 g/mol. Its IUPAC name is 4-bromo-3-(2-methoxyethoxysulfamoyl)-5-methylbenzoic acid.
| Compound Name | 4-bromo-3-(2-methoxyethoxysulfamoyl)-5-methylbenzoic acid |
|---|---|
| PubChem CID | 114362735 |
| Molecular Formula | C11H14BrNO6S |
| Molecular Weight | 368.21 g/mol |
| Exact Mass | 366.97 |
| IUPAC Name | 4-bromo-3-(2-methoxyethoxysulfamoyl)-5-methylbenzoic acid |
| SMILES | COCCONS(=O)(=O)c1cc(C(=O)O)cc(C)c1Br |
| InChI | InChI=1S/C11H14BrNO6S/c1-7-5-8(11(14)15)6-9(10(7)12)20(16,17)13-19-4-3-18-2/h5-6,13H,3-4H2,1-2H3,(H,14,15) |
| InChIKey | ZZVJSOBVDJGRDK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|