C13H18BrNO5S — CID 114362874
4-bromo-3-[(3-hydroxy-2-methylbutan-2-yl)sulfamoyl]-5-methylbenzoic acid (PubChem CID 114362874) has the molecular formula C13H18BrNO5S and a molecular weight of 380.26 g/mol. Its IUPAC name is 4-bromo-3-[(3-hydroxy-2-methylbutan-2-yl)sulfamoyl]-5-methylbenzoic acid.
| Compound Name | 4-bromo-3-[(3-hydroxy-2-methylbutan-2-yl)sulfamoyl]-5-methylbenzoic acid |
|---|---|
| PubChem CID | 114362874 |
| Molecular Formula | C13H18BrNO5S |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | 4-bromo-3-[(3-hydroxy-2-methylbutan-2-yl)sulfamoyl]-5-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(S(=O)(=O)NC(C)(C)C(C)O)c1Br |
| InChI | InChI=1S/C13H18BrNO5S/c1-7-5-9(12(17)18)6-10(11(7)14)21(19,20)15-13(3,4)8(2)16/h5-6,8,15-16H,1-4H3,(H,17,18) |
| InChIKey | SFYXQVMUGTWYPW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |