C11H16N2O5S — CID 62268095
5-(3-aminopropylsulfamoyl)-2-hydroxy-4-methylbenzoic acid (PubChem CID 62268095) has the molecular formula C11H16N2O5S and a molecular weight of 288.32 g/mol. Its IUPAC name is 5-(3-aminopropylsulfamoyl)-2-hydroxy-4-methylbenzoic acid.
| Compound Name | 5-(3-aminopropylsulfamoyl)-2-hydroxy-4-methylbenzoic acid |
|---|---|
| PubChem CID | 62268095 |
| Molecular Formula | C11H16N2O5S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 5-(3-aminopropylsulfamoyl)-2-hydroxy-4-methylbenzoic acid |
| SMILES | Cc1cc(O)c(C(=O)O)cc1S(=O)(=O)NCCCN |
| InChI | InChI=1S/C11H16N2O5S/c1-7-5-9(14)8(11(15)16)6-10(7)19(17,18)13-4-2-3-12/h5-6,13-14H,2-4,12H2,1H3,(H,15,16) |
| InChIKey | GVQVWZLPTIVEOH-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|