C15H16N2O7S2 — CID 55676420
2-hydroxy-5-[[2-(methanesulfonamido)phenyl]sulfamoyl]-4-methylbenzoic acid (PubChem CID 55676420) has the molecular formula C15H16N2O7S2 and a molecular weight of 400.43 g/mol. Its IUPAC name is 2-hydroxy-5-[[2-(methanesulfonamido)phenyl]sulfamoyl]-4-methylbenzoic acid.
| Compound Name | 2-hydroxy-5-[[2-(methanesulfonamido)phenyl]sulfamoyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 55676420 |
| Molecular Formula | C15H16N2O7S2 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 2-hydroxy-5-[[2-(methanesulfonamido)phenyl]sulfamoyl]-4-methylbenzoic acid |
| SMILES | Cc1cc(O)c(C(=O)O)cc1S(=O)(=O)Nc1ccccc1NS(C)(=O)=O |
| InChI | InChI=1S/C15H16N2O7S2/c1-9-7-13(18)10(15(19)20)8-14(9)26(23,24)17-12-6-4-3-5-11(12)16-25(2,21)22/h3-8,16-18H,1-2H3,(H,19,20) |
| InChIKey | XHUKODBTVPTSIT-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 149.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |