C10H10Cl2FNO4S — CID 122067620
4-[(2,6-dichloro-4-fluorophenyl)sulfonylamino]butanoic acid (PubChem CID 122067620) has the molecular formula C10H10Cl2FNO4S and a molecular weight of 330.16 g/mol. Its IUPAC name is 4-[(2,6-dichloro-4-fluorophenyl)sulfonylamino]butanoic acid.
| Compound Name | 4-[(2,6-dichloro-4-fluorophenyl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 122067620 |
| Molecular Formula | C10H10Cl2FNO4S |
| Molecular Weight | 330.16 g/mol |
| Exact Mass | 328.97 |
| IUPAC Name | 4-[(2,6-dichloro-4-fluorophenyl)sulfonylamino]butanoic acid |
| SMILES | O=C(O)CCCNS(=O)(=O)c1c(Cl)cc(F)cc1Cl |
| InChI | InChI=1S/C10H10Cl2FNO4S/c11-7-4-6(13)5-8(12)10(7)19(17,18)14-3-1-2-9(15)16/h4-5,14H,1-3H2,(H,15,16) |
| InChIKey | UPOSGRZDJHEVHW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.16 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|