C9H8F3NO4S — CID 54881721
3-[(2,4,6-trifluorophenyl)sulfonylamino]propanoic acid (PubChem CID 54881721) has the molecular formula C9H8F3NO4S and a molecular weight of 283.23 g/mol. Its IUPAC name is 3-[(2,4,6-trifluorophenyl)sulfonylamino]propanoic acid.
| Compound Name | 3-[(2,4,6-trifluorophenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 54881721 |
| Molecular Formula | C9H8F3NO4S |
| Molecular Weight | 283.23 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | 3-[(2,4,6-trifluorophenyl)sulfonylamino]propanoic acid |
| SMILES | O=C(O)CCNS(=O)(=O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C9H8F3NO4S/c10-5-3-6(11)9(7(12)4-5)18(16,17)13-2-1-8(14)15/h3-4,13H,1-2H2,(H,14,15) |
| InChIKey | ZDLYGYAVAHRNLK-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.23 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |